L-Histidine

L-histidine structural formula

Structural formula

Business number 01GC
Molecular formula C6H9N3O2
Molecular weight 155.16
label

L-A-Amino-?-4-imidazolylpropionic acid,

(S)-2-Amino-3-(4-imidazolyl)propionic acid,

Histidine,

Alpha-amino-1H-imidazole-4-propionic acid,

Imidazole-5-alanine,

2-Amine-3-imidazolepropionic acid,

L-2-amino-3-(4-imidazolyl)propionic acid,

L-alpha-Amino-beta-imidazolepropionic acid,

(S)-2-Amino-1H-imidazole-4-propanoic acid Glyoxaline-5-alanine,

Flavor enhancers and nutritional supplements,

amino acids,

intermediates,

Biochemical reagents

Numbering system

CAS number:71-00-1

MDL number:MFCD00064315

EINECS number:200-745-3

RTECS number:MS3070000

BRN number:84088

PubChem ID:None

Physical property data

1. Properties: white crystal or crystalline powder. Odorless. Slightly bitter

2. Density (g/mL, 25/4?): 1.423

3. Relative vapor density (g/mL, air=1): Uncertain

4. Melting point (ºC): 287(dec.)(lit.)

5. Boiling point (ºC, normal pressure): Uncertain

6. Boiling point (ºC, 5.2kPa): Uncertain

7. Refractive index: 13° (C=11, 6mol/L HCl)

8. Flash point (ºC): Uncertain Confirm

9. Specific rotation (º): 12.4 º (c=11,6N HCl)

10. Autoignition point or ignition temperature (ºC): Uncertain

p>

11. Vapor pressure (kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa, 60ºC): Uncertain

13. Heat of combustion (KJ /mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa): Uncertain

16. Oil and water Log value of (octanol/water) partition coefficient: Uncertain

17. Explosion upper limit (%, V/V): Uncertain

18. Explosion lower limit (%, V /V): Uncertain

19. Solubility: soluble in water (4.3g/100ml, 25?), extremely insoluble in ethanol, insoluble in ether

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 38.01

2. Molar volume (cm3/mol): 108.9

3. Isotonic specific volume (90.2K ): 325.6

4. Surface tension (dyne/cm): 79.6

5. Polarizability (10-24cm3): 15.07

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): -3.2

2. Number of hydrogen bond donors: 3

3. Number of hydrogen bond acceptors: 4

p>

4. Number of rotatable chemical bonds: 3

5. Number of tautomers: 2

6. Topological molecular polar surface area (TPSA): 92

7. Number of heavy atoms: 11

8. Surface charge: 0

9. Complexity: 151

10. Isotopic atoms Quantity: 0

11. Determine the number of atomic stereocenters: 1

12. Uncertain number of atomic stereocenters: 0

13. Determine the chemical bond establishment Number of stereocenters: 0

14, Number of uncertain chemical bond stereocenters: 0

15, Number of covalent bond units: 1

Properties and stability

1. Found in flue-cured tobacco leaves and burley tobacco leaves.

Storage method

?The basic amino acid part of protein hydrolyzate is separated by ion exchange resin.

? It is made from sugar as raw material and produced by fermentation method.

Fermentation of induced drug-resistant strains of Glucobrevibacterium glutamicum, Corynebacterium glutamicum, S. marcescens, etc.

L-Histidine

Synthesis method

1. Extracted from pig blood and cow blood. Pig blood is spray-dried to produce blood meal. Every 100kg of pig blood is about 18kg of blood meal. L-Histidine is commonly used as its hydrochloride ([7048-02-4]). Concentrate the eluate containing L-histidine until crystallization appears, adjust the pH to 2.5 with hydrochloric acid while hot, immediately add ethanol twice the amount of the solution, let it stand, precipitate, and filter to obtain L-histidine. The crude hydrochloride salt is decolorized, recrystallized and dried to obtain the finished product. L-histidine can also be extracted from the hydrolyzate of defatted soybeans.

2.Direct fermentation method

3. Tobacco: BU, 22; FC, 21. Its imidazole easily forms complex salts with metal ions.

Purpose

1. Mainly used as flavor enhancer and nutritional supplement. It can also be used in food for infants and young children and food for post-operative patients. It is also an important component of amino acid infusion and comprehensive amino acid preparations.

extended-reading:https://www.cyclohexylamine.net/polycat-17-trimethylhydroxyethyl-propanediamine/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2020/06/25.jpg
extended-reading:https://www.newtopchem.com/archives/1039
extended-reading:https://www.bdmaee.net/polyurethane-thermal-delay-catalyst-nt-cate-129-heat-sensitive-metal-catalyst/
extended-reading:https://www.newtopchem.com/archives/1862
extended-reading:https://www.cyclohexylamine.net/lupragen-n104-pc-cat-nem/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/37-2.jpg
extended-reading:https://www.newtopchem.com/archives/1598
extended-reading:https://www.bdmaee.net/lupragen-n700-catalyst-cas-6674-22-2-basf/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/New-generation-sponge-hardener.pdf

3-iodo-L-tyrosine

3-iodo-L-tyrosine structure

Structural formula

Business number 01GB
Molecular formula C9H10INO3
Molecular weight 307.09
label

3-iodo-L-phenylaminopropionic acid,

3-Monoiodo-L-tyrosine,

IC6H3-4-(OH)CH2CH(NH2)CO2H

Numbering system

CAS number:70-78-0

MDL number:MFCD00002608

EINECS number:200-744-8

RTECS number:None

BRN number:2941266

PubChem ID:None

Physical property data

1. Properties: white crystal. It is unstable to light and releases iodine. Sensitive to air.

2. Density (g/mL, 25/4?): Undetermined

3. Relative vapor density (g/mL, air=1): Undetermined

4. Melting point (ºC): 204~206? (decomposition)

5. Boiling point (ºC, normal pressure): Undetermined

6. Boiling point (ºC, normal pressure) 5.2kPa): Not determined

7. Refractive index: Not determined

8. Flash point (ºC): Not determined

9. Specific rotation ( º): [?]D20 -4.4° (C=5, in 1mol/L hydrochloric acid)

10. Autoignition point or ignition temperature (ºC): Undetermined

11 . Vapor pressure (kPa, 25ºC): Undetermined

12. Saturation vapor pressure (kPa, 60ºC): Undetermined

13. Heat of combustion (KJ/mol): Undetermined

14. Critical temperature (ºC): Undetermined

15. Critical pressure (KPa): Undetermined

16. Oil and water (octanol/water) Log value of distribution coefficient: Undetermined

17. Explosion upper limit (%, V/V): Undetermined

18. Explosion lower limit (%, V/V): Undetermined

19. Solubility: soluble in 15 parts of boiling water, soluble in dilute alkali, slightly soluble in water.

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 60.28

2. Molar volume (cm3/mol): 157.9

3. Isotonic specific volume (90.2K ): 462.4

4. Surface tension (dyne/cm): 73.5

5. Polarizability (10-24cm3): 23.89

Compute chemical data

1. Hydrophobic parameter calculation reference value (XlogP): -1.1

2. Number of hydrogen bond donors: 3

3. Number of hydrogen bond acceptors: 4

p>

4. Number of rotatable chemical bonds: 3

5. Number of tautomers: 3

6. Topological molecular polar surface area (TPSA): 83.6

7.Number of heavy atoms: 14

8, Surface charge: 0

9, Complexity: 212

10, Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 1

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. The number of uncertain stereocenters of chemical bonds: 0

15. The number of covalent bonding units: 1

Properties and stability

None

Storage method

This product should be sealed and stored in a dry place below 0? and protected from light.

Synthesis method

None

Purpose

Used in biochemical research as an inhibitor of tyrosine hydroxylase. ????

extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Lupragen-DMI-gel-catalyst-Lupragen-DMI-epoxy-resin-curing-agent-Lupragen-DMI.pdf
extended-reading:https://www.bdmaee.net/dabco-mp602-catalyst-cas31506-44-2-evonik-germany/
extended-reading:https://www.newtopchem.com/archives/category/products/page/22
extended-reading:https://www.bdmaee.net/cas-2273-45-2/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/-BX405-low-odor-amine-catalyst-BX405–BX405-polyurethane-catalyst.pdf
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/40.jpg
extended-reading:https://www.newtopchem.com/archives/45168
extended-reading:https://www.newtopchem.com/archives/39763
extended-reading:https://www.newtopchem.com/archives/44356
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Tetramethylpropanediamine-CAS110-95-2-TMPDA.pdf

4′-Hydroxypropiophenone

4'-hydroxypropiophenone structural formula

Structural formula

Business number 01GA
Molecular formula C9H10O2
Molecular weight 150.18
label

p-Hydroxypropiophenone,

4-Hydroxypropiophenone,

p-propionylphenol,

Hydrolyzed polyacrylamide,

HOC6H4COC2H5

Numbering system

CAS number:70-70-2

MDL number:MFCD00002361

EINECS number:200-743-2

RTECS number:UH1925000

BRN number:907511

PubChem ID:None

Physical property data

1. Character: white needle-like or prismatic crystal

2. Density (g/mL, 25/4?): Uncertain

3. Relative vapor density ( g/mL, air=1): Uncertain

4. Melting point (ºC): 36-38(lit.)

5. Boiling point (ºC, normal pressure): Not available Confirm

6. Boiling point (ºC, 26mmHg): 152-154(lit.)

7. Refractive index: Uncertain

8. Flash point ( ºF): >230

9. Specific rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure (kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa, 60ºC): Uncertain

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa): Uncertain

16. Oil and water (octanol/ Log value of the partition coefficient (water): Uncertain

17. Explosion upper limit (%, V/V): Uncertain

18. Explosion lower limit (%, V/V): Uncertain

19. Solubility: Slightly soluble in water (0.34 g/l, 15 ºC), easily soluble in boiling water, miscible with alcohol and ether

Toxicological data

Acute toxicity: rat oral LD: >500 mg/kg; mouse intraperitoneal LD50: 200 mg/kg; mouse subcutaneous injection LD50: 1130 ug/kg; kg; breeding: rat intramuscular TDLo: 1600 mg/kgSEX/DURATION: female 15-30 day(s) after conception;

Ecological data

None

Molecular structure data

1. Molar refractive index: 42.79

2. Molar volume (cm3/mol): 135.9

3. Isotonic specific volume (90.2K ): 347.2

4. Surface tension (dyne/cm): 42.6

5. Polarizability (10-24cm3): 16.96

Computing chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 2

4. Number of rotatable chemical bonds: 2

5. Number of tautomers: 7

6. Topological molecule polar surface area 37.3

7. Number of heavy atoms: 11

8. Surface charge: 0

9. Complexity: 135

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

This product should be sealed and stored in a cool, dry and dark place.

Synthesis method

Add anhydrous aluminum trichloride to carbon disulfide, stir, and add phenyl propionate dropwise. The reaction occurs immediately and hydrogen chloride is released. The carbon disulfide refluxes due to the heat generated by the reaction. After the dropwise addition is completed, the reaction mixture is heated to reflux for 2 hours until hydrogen chloride no longer escapes. The carbon disulfide is evaporated, the temperature is raised to 140-150°C and kept for 3 hours, and hydrogen chloride is released. The resulting resinous substance is cooled, and hydrochloric acid and water are slowly added to decompose the aluminum double salt. Place in the refrigerator overnight, filter, and recrystallize the filter cake with methanol to obtain p-hydroxypropiophenone, with a yield of 34-39%.

Purpose

Organic synthesis. Used as liquid crystal raw materials and intermediates.

extended-reading:https://www.newtopchem.com/archives/44462
extended-reading:https://www.bdmaee.net/jeffcat-dmea-catalyst-cas107-15-3-huntsman/
extended-reading:https://www.newtopchem.com/archives/44971
extended-reading:https://www.newtopchem.com/archives/44428
extended-reading:https://www.morpholine.org/delayed-catalyst/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2020/07/NEWTOP4.jpg
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/42.jpg
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Dibutyltin-monooctyl-maleate-CAS25168-21-2-BT-58C.pdf
extended-reading:https://www.bdmaee.net/jeffcat-zr-70-catalyst-cas1704-62-7-huntsman/
extended-reading:https://www.newtopchem.com/archives/1875