3-iodo-L-tyrosine

3-iodo-L-tyrosine structure

Structural formula

Business number 01GB
Molecular formula C9H10INO3
Molecular weight 307.09
label

3-iodo-L-phenylaminopropionic acid,

3-Monoiodo-L-tyrosine,

IC6H3-4-(OH)CH2CH(NH2)CO2H

Numbering system

CAS number:70-78-0

MDL number:MFCD00002608

EINECS number:200-744-8

RTECS number:None

BRN number:2941266

PubChem ID:None

Physical property data

1. Properties: white crystal. It is unstable to light and releases iodine. Sensitive to air.

2. Density (g/mL, 25/4?): Undetermined

3. Relative vapor density (g/mL, air=1): Undetermined

4. Melting point (ºC): 204~206? (decomposition)

5. Boiling point (ºC, normal pressure): Undetermined

6. Boiling point (ºC, normal pressure) 5.2kPa): Not determined

7. Refractive index: Not determined

8. Flash point (ºC): Not determined

9. Specific rotation ( º): [?]D20 -4.4° (C=5, in 1mol/L hydrochloric acid)

10. Autoignition point or ignition temperature (ºC): Undetermined

11 . Vapor pressure (kPa, 25ºC): Undetermined

12. Saturation vapor pressure (kPa, 60ºC): Undetermined

13. Heat of combustion (KJ/mol): Undetermined

14. Critical temperature (ºC): Undetermined

15. Critical pressure (KPa): Undetermined

16. Oil and water (octanol/water) Log value of distribution coefficient: Undetermined

17. Explosion upper limit (%, V/V): Undetermined

18. Explosion lower limit (%, V/V): Undetermined

19. Solubility: soluble in 15 parts of boiling water, soluble in dilute alkali, slightly soluble in water.

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 60.28

2. Molar volume (cm3/mol): 157.9

3. Isotonic specific volume (90.2K ): 462.4

4. Surface tension (dyne/cm): 73.5

5. Polarizability (10-24cm3): 23.89

Compute chemical data

1. Hydrophobic parameter calculation reference value (XlogP): -1.1

2. Number of hydrogen bond donors: 3

3. Number of hydrogen bond acceptors: 4

p>

4. Number of rotatable chemical bonds: 3

5. Number of tautomers: 3

6. Topological molecular polar surface area (TPSA): 83.6

7.Number of heavy atoms: 14

8, Surface charge: 0

9, Complexity: 212

10, Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 1

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. The number of uncertain stereocenters of chemical bonds: 0

15. The number of covalent bonding units: 1

Properties and stability

None

Storage method

This product should be sealed and stored in a dry place below 0? and protected from light.

Synthesis method

None

Purpose

Used in biochemical research as an inhibitor of tyrosine hydroxylase. ????

extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Lupragen-DMI-gel-catalyst-Lupragen-DMI-epoxy-resin-curing-agent-Lupragen-DMI.pdf
extended-reading:https://www.bdmaee.net/dabco-mp602-catalyst-cas31506-44-2-evonik-germany/
extended-reading:https://www.newtopchem.com/archives/category/products/page/22
extended-reading:https://www.bdmaee.net/cas-2273-45-2/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/-BX405-low-odor-amine-catalyst-BX405–BX405-polyurethane-catalyst.pdf
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/40.jpg
extended-reading:https://www.newtopchem.com/archives/45168
extended-reading:https://www.newtopchem.com/archives/39763
extended-reading:https://www.newtopchem.com/archives/44356
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Tetramethylpropanediamine-CAS110-95-2-TMPDA.pdf

4′-Hydroxypropiophenone

4'-hydroxypropiophenone structural formula

Structural formula

Business number 01GA
Molecular formula C9H10O2
Molecular weight 150.18
label

p-Hydroxypropiophenone,

4-Hydroxypropiophenone,

p-propionylphenol,

Hydrolyzed polyacrylamide,

HOC6H4COC2H5

Numbering system

CAS number:70-70-2

MDL number:MFCD00002361

EINECS number:200-743-2

RTECS number:UH1925000

BRN number:907511

PubChem ID:None

Physical property data

1. Character: white needle-like or prismatic crystal

2. Density (g/mL, 25/4?): Uncertain

3. Relative vapor density ( g/mL, air=1): Uncertain

4. Melting point (ºC): 36-38(lit.)

5. Boiling point (ºC, normal pressure): Not available Confirm

6. Boiling point (ºC, 26mmHg): 152-154(lit.)

7. Refractive index: Uncertain

8. Flash point ( ºF): >230

9. Specific rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure (kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa, 60ºC): Uncertain

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa): Uncertain

16. Oil and water (octanol/ Log value of the partition coefficient (water): Uncertain

17. Explosion upper limit (%, V/V): Uncertain

18. Explosion lower limit (%, V/V): Uncertain

19. Solubility: Slightly soluble in water (0.34 g/l, 15 ºC), easily soluble in boiling water, miscible with alcohol and ether

Toxicological data

Acute toxicity: rat oral LD: >500 mg/kg; mouse intraperitoneal LD50: 200 mg/kg; mouse subcutaneous injection LD50: 1130 ug/kg; kg; breeding: rat intramuscular TDLo: 1600 mg/kgSEX/DURATION: female 15-30 day(s) after conception;

Ecological data

None

Molecular structure data

1. Molar refractive index: 42.79

2. Molar volume (cm3/mol): 135.9

3. Isotonic specific volume (90.2K ): 347.2

4. Surface tension (dyne/cm): 42.6

5. Polarizability (10-24cm3): 16.96

Computing chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 2

4. Number of rotatable chemical bonds: 2

5. Number of tautomers: 7

6. Topological molecule polar surface area 37.3

7. Number of heavy atoms: 11

8. Surface charge: 0

9. Complexity: 135

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

This product should be sealed and stored in a cool, dry and dark place.

Synthesis method

Add anhydrous aluminum trichloride to carbon disulfide, stir, and add phenyl propionate dropwise. The reaction occurs immediately and hydrogen chloride is released. The carbon disulfide refluxes due to the heat generated by the reaction. After the dropwise addition is completed, the reaction mixture is heated to reflux for 2 hours until hydrogen chloride no longer escapes. The carbon disulfide is evaporated, the temperature is raised to 140-150°C and kept for 3 hours, and hydrogen chloride is released. The resulting resinous substance is cooled, and hydrochloric acid and water are slowly added to decompose the aluminum double salt. Place in the refrigerator overnight, filter, and recrystallize the filter cake with methanol to obtain p-hydroxypropiophenone, with a yield of 34-39%.

Purpose

Organic synthesis. Used as liquid crystal raw materials and intermediates.

extended-reading:https://www.newtopchem.com/archives/44462
extended-reading:https://www.bdmaee.net/jeffcat-dmea-catalyst-cas107-15-3-huntsman/
extended-reading:https://www.newtopchem.com/archives/44971
extended-reading:https://www.newtopchem.com/archives/44428
extended-reading:https://www.morpholine.org/delayed-catalyst/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2020/07/NEWTOP4.jpg
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/42.jpg
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Dibutyltin-monooctyl-maleate-CAS25168-21-2-BT-58C.pdf
extended-reading:https://www.bdmaee.net/jeffcat-zr-70-catalyst-cas1704-62-7-huntsman/
extended-reading:https://www.newtopchem.com/archives/1875

p-toluenesulfonamide

Structural formula of p-toluenesulfonamide

Structural formula

Business number 01G8
Molecular formula C7H9NO2S
Molecular weight 171.22
label

4-Toluenesulfonamide,

To sulfonamide,

Toluene-4-sulfonamide,

Toluenesulfonamide,

p-sulfonamide toluene,

4-Toluene sulfonamide,

On sulfonamide,

Toluene-4-sulfonamide,

Toluene sulfonamide,

On ammonia toluene sulfonyl,

Toughening agent,

aromatic sulfur compounds

Numbering system

CAS number:70-55-3

MDL number:MFCD00011692

EINECS number:200-741-1

RTECS number:XT5075000

BRN number:472689

PubChem number:24854164

Physical property data

1. Character: White flake or leaf-like crystal

2. Density (g/mL, 25/4?): Uncertain

3. Relative vapor density ( g/mL, air=1): Uncertain

4. Melting point (ºC): 138.5?139

5. Boiling point (ºC, normal pressure): Uncertain

6. Boiling point (ºC, 10mmHg): 221

7. Refractive index: Uncertain

8. Flash point (ºC): 202

9. Specific rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure (kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa, 60ºC): Uncertain

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa): Uncertain

16 . The logarithmic value of the oil-water (octanol/water) partition coefficient: Uncertain

17. Explosion upper limit (%, V/V): Uncertain

18. Explosion lower limit (% ,V/V): Uncertain

19. Solubility: Soluble in ethanol, insoluble in water (0.32 g/100 mL, 25 º C) and ether.

Toxicological data

Acute toxicity: mouse intraperitoneal LC50: 250 mg/kg; subcutaneous injection of LDLo in guinea pigs: 2 mg/kg; oral LD50 of wild birds: 75 mg/kg; mutagenicity: Salmonella microbial changes test system: 40 umol/plate;

Ecological data

None

Molecular structure data

1. Molar refractive index: 43.81

2. Molar volume (cm3/mol): 134.6

3. Isotonic specific volume (90.2K ): 351.2

4. Surface tension (dyne/cm): 46.3

5. Polarizability (10-24cm3): 17.36

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 3

4. Number of rotatable chemical bonds: 1

5. Number of tautomers: none

6. Topological molecule polar surface area 68.5

7. Number of heavy atoms: 11

8. Surface charge: 0

9. Complexity: 209

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

Storage method

1. Packed in an inner plastic bag, an outer woven bag or an inner plastic bag, a middle layer of kraft paper bag, and an outer woven bag. Handle it with care during storage and transportation, and protect it from moisture and heat. Store and transport according to regulations for flammable and toxic substances. 2. This product should be stored in a sealed, cool and dry place.

Synthesis method

1. Obtained from the reaction of p-toluenesulfonyl chloride and ammonia. Process flow: first put an appropriate amount of ice water into the amination pot, and then mix it according to the mass Ratio (p-toluenesulfonyl chloride: pure ammonia = 1:0.2). Put the measured p-toluenesulfonyl chloride and ammonia water into the pot in sequence, start the stirrer, and use the cold liquid in the amination pot jacket to control the temperature in the pot to about 70°C. (This reaction generates a lot of heat), then lower the temperature to about 30°C and discharge the material. Put the amination into a filter bucket and filter, wash with warm water, and blot dry to obtain solid powdery crude p-toluenesulfonamide. Crude p-toluenesulfonamide contains a small amount of o-toluene sulfonamide by-product, oily colored substance. The purpose of purification and refining can be achieved by utilizing the property of para-amine to be easily soluble in sodium hydroxide solution and using activated carbon for decolorization. The material mass ratio is crude para-amine: 30% sodium hydroxide, liquid alkali: water = 100: 45: 1300; crude para-amine: activated carbon = 100: (2.5-3.5). Put the water and caustic soda into the purification pot according to the formula amount, open the jacketed steam valve and heat it to 70°C, then add the formula amount of crude para-amine, start the rear stirrer, and wait until the crude para-amine is completely dissolved. Add the formula amount of activated carbon, continue stirring for 0.5h, put the material liquid into the filter barrel, filter it with heat, wash it with hot water, and suck it dry. The filtrate is immediately poured into the refining pot, neutralized with hydrochloric acid to PH value = 2-3, and cooled to about 30-35°C. The material liquid is put into a filter barrel to filter, then washed with water until neutral, moved to a centrifuge and centrifuged to dry, that is It is a finished product containing 10% water. If a dry product is required, it is sent to an air flow dryer for drying to obtain a finished p-toluenesulfonamide product containing 1% water. 2. For p-toluenesulfonyl chloride and Pure ammonia was added to the ice water in sequence, and the mass ratio of p-toluenesulfonyl chloride and pure ammonia was controlled to be 1:0.2. The reaction was carried out under stirring, and the temperature was cooled and controlled to 70°C. After the reaction is completed, After cooling, filtering and washing, the crude product is obtained. The crude product is subjected to alkali washing, decolorization, water washing, neutralization, filtration, water washing and drying to obtain the finished product.

Purpose

1. Used in organic synthesis. p-Toluenesulfonamide is mainly used in the synthesis of chloramine-T and chloramphenicol (Tevenel). 2. Used for synthesizing fluorescent dyes, manufacturing plasticizers, synthetic resins, coatings, disinfectants and wood processing brighteners, etc. 3. Mainly used as a toughening agent for the synthesis of water-soluble melamine formaldehyde resin. 4.Used as primary brightener in bright nickel plating. Used for bright multi-layer nickel plating to make the coating bright and uniform. The general dosage is 0.2~0.3g/L.

extended-reading:https://www.newtopchem.com/archives/538
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/-25-S-Lupragen-N202-TEDA-L25B.pdf
extended-reading:https://www.newtopchem.com/archives/44038
extended-reading:https://www.bdmaee.net/nt-cat-t45-catalyst-cas121-143-5-newtopchem/
extended-reading:https://www.newtopchem.com/archives/42992
extended-reading:https://www.newtopchem.com/archives/44937
extended-reading:https://www.newtopchem.com/archives/category/products/page/92
extended-reading:https://www.morpholine.org/category/morpholine/page/9/
extended-reading:https://www.newtopchem.com/archives/968
extended-reading:https://www.newtopchem.com/archives/1037